ChemNet > CAS > 31270-80-1 4-chlorofuro[3,2-c]pyridine
31270-80-1 4-chlorofuro[3,2-c]pyridine
| Ürün Adı |
4-chlorofuro[3,2-c]pyridine |
| Moleküler Formülü |
C7H4ClNO |
| Molekül Ağırlığı |
153.5658 |
| InChI |
InChI=1/C7H4ClNO/c8-7-5-2-4-10-6(5)1-3-9-7/h1-4H |
| CAS kayıt numarası |
31270-80-1 |
| Moleküler Yapısı |
![31270-80-1 4-chlorofuro[3,2-c]pyridine](https://images-a.chemnet.com/suppliers/chembase/213/21301.gif)
|
| Yoğunluk |
1.377g/cm3 |
| Ergime noktası |
40℃ |
| Kaynama noktası |
242.806°C at 760 mmHg |
| Kırılma indisi |
1.624 |
| Alevlenme noktası |
100.646°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
